C10H21N5O2 — CID 176529270
2-[[amino(carbamimidamido)methylidene]amino]octanoic acid (PubChem CID 176529270) has the molecular formula C10H21N5O2 and a molecular weight of 243.31 g/mol. Its IUPAC name is 2-[[amino(carbamimidamido)methylidene]amino]octanoic acid.
| Compound Name | 2-[[amino(carbamimidamido)methylidene]amino]octanoic acid |
|---|---|
| PubChem CID | 176529270 |
| Molecular Formula | C10H21N5O2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 2-[[amino(carbamimidamido)methylidene]amino]octanoic acid |
| SMILES | [H]/N=C(\N)N/C(N)=N/C(CCCCCC)C(=O)O |
| InChI | InChI=1S/C10H21N5O2/c1-2-3-4-5-6-7(8(16)17)14-10(13)15-9(11)12/h7H,2-6H2,1H3,(H,16,17)(H6,11,12,13,14,15) |
| InChIKey | CZQBPFYCUUJYEX-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 137.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|