C8H19Cl2N5 — CID 176522828
1-carbamimidoyl-2-(6-chlorohexan-3-yl)guanidine;hydrochloride (PubChem CID 176522828) has the molecular formula C8H19Cl2N5 and a molecular weight of 256.18 g/mol. Its IUPAC name is 1-carbamimidoyl-2-(6-chlorohexan-3-yl)guanidine;hydrochloride.
| Compound Name | 1-carbamimidoyl-2-(6-chlorohexan-3-yl)guanidine;hydrochloride |
|---|---|
| PubChem CID | 176522828 |
| Molecular Formula | C8H19Cl2N5 |
| Molecular Weight | 256.18 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 1-carbamimidoyl-2-(6-chlorohexan-3-yl)guanidine;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N/C(N)=N/C(CC)CCCCl |
| InChI | InChI=1S/C8H18ClN5.ClH/c1-2-6(4-3-5-9)13-8(12)14-7(10)11;/h6H,2-5H2,1H3,(H6,10,11,12,13,14);1H |
| InChIKey | CBKOEHUYVONSRV-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.18 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|