C18H35N4NaO3 — CID 132917583
sodium N-[(1S)-1-carboxy-4-(diaminomethylideneamino)butyl]dodecanimidate (PubChem CID 132917583) has the molecular formula C18H35N4NaO3 and a molecular weight of 378.49 g/mol. Its IUPAC name is sodium N-[(1S)-1-carboxy-4-(diaminomethylideneamino)butyl]dodecanimidate.
| Compound Name | sodium N-[(1S)-1-carboxy-4-(diaminomethylideneamino)butyl]dodecanimidate |
|---|---|
| PubChem CID | 132917583 |
| Molecular Formula | C18H35N4NaO3 |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | sodium N-[(1S)-1-carboxy-4-(diaminomethylideneamino)butyl]dodecanimidate |
| SMILES | CCCCCCCCCCC/C([O-])=N/[C@@H](CCCN=C(N)N)C(=O)O.[Na+] |
| InChI | InChI=1S/C18H36N4O3.Na/c1-2-3-4-5-6-7-8-9-10-13-16(23)22-15(17(24)25)12-11-14-21-18(19)20;/h15H,2-14H2,1H3,(H,22,23)(H,24,25)(H4,19,20,21);/q;+1/p-1/t15-;/m0./s1 |
| InChIKey | ZCDHYQRTAHRFLV-RSAXXLAASA-M |
| XLogP | -0.82 |
| TPSA | 137.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|