C12H26N8O3 — CID 173236430
pentanoyl (2S)-2-amino-5-[[amino(hydrazinyl)methylidene]amino]-5-(diaminomethylideneamino)pentanoate (PubChem CID 173236430) has the molecular formula C12H26N8O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is pentanoyl (2S)-2-amino-5-[[amino(hydrazinyl)methylidene]amino]-5-(diaminomethylideneamino)pentanoate.
| Compound Name | pentanoyl (2S)-2-amino-5-[[amino(hydrazinyl)methylidene]amino]-5-(diaminomethylideneamino)pentanoate |
|---|---|
| PubChem CID | 173236430 |
| Molecular Formula | C12H26N8O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | pentanoyl (2S)-2-amino-5-[[amino(hydrazinyl)methylidene]amino]-5-(diaminomethylideneamino)pentanoate |
| SMILES | CCCCC(=O)OC(=O)[C@@H](N)CCC(N=C(N)N)N=C(N)NN |
| InChI | InChI=1S/C12H26N8O3/c1-2-3-4-9(21)23-10(22)7(13)5-6-8(18-11(14)15)19-12(16)20-17/h7-8H,2-6,13,17H2,1H3,(H4,14,15,18)(H3,16,19,20)/t7-,8?/m0/s1 |
| InChIKey | BAEVOLQUNJQLQL-JAMMHHFISA-N |
| XLogP | -2.27 |
| TPSA | 210.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|