C6H16N4O — CID 104865678
1-amino-2-(4-hydroxy-3-methylbutan-2-yl)guanidine (PubChem CID 104865678) has the molecular formula C6H16N4O and a molecular weight of 160.22 g/mol. Its IUPAC name is 1-amino-2-(4-hydroxy-3-methylbutan-2-yl)guanidine.
| Compound Name | 1-amino-2-(4-hydroxy-3-methylbutan-2-yl)guanidine |
|---|---|
| PubChem CID | 104865678 |
| Molecular Formula | C6H16N4O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | 1-amino-2-(4-hydroxy-3-methylbutan-2-yl)guanidine |
| SMILES | CC(CO)C(C)/N=C(\N)NN |
| InChI | InChI=1S/C6H16N4O/c1-4(3-11)5(2)9-6(7)10-8/h4-5,11H,3,8H2,1-2H3,(H3,7,9,10) |
| InChIKey | ZHWAWKBOWNFHCA-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|