About hydrazinecarboxylic acid;neodymium;2-(propan-2-yldisulfanyl)propane
hydrazinecarboxylic acid;neodymium;2-(propan-2-yldisulfanyl)propane (PubChem CID 158608952) has the molecular formula C7H18N2NdO2S2
and a molecular weight of 370.61 g/mol. Its IUPAC name is hydrazinecarboxylic acid;neodymium;2-(propan-2-yldisulfanyl)propane.
Molecular Properties
| Compound Name | hydrazinecarboxylic acid;neodymium;2-(propan-2-yldisulfanyl)propane |
| PubChem CID | 158608952 |
| Molecular Formula | C7H18N2NdO2S2 |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | hydrazinecarboxylic acid;neodymium;2-(propan-2-yldisulfanyl)propane |
| SMILES | CC(C)SSC(C)C.NNC(=O)O.[Nd] |
| InChI | InChI=1S/C6H14S2.CH4N2O2.Nd/c1-5(2)7-8-6(3)4;2-3-1(4)5;/h5-6H,1-4H3;3H,2H2,(H,4,5); |
| InChIKey | HWOYACQEQVVIPL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydrazinecarboxylic acid;neodymium;2-(propan-2-yldisulfanyl)propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazinecarboxylic acid;neodymium;2-(propan-2-yldisulfanyl)propane?
The IUPAC name of hydrazinecarboxylic acid;neodymium;2-(propan-2-yldisulfanyl)propane (CID 158608952) is hydrazinecarboxylic acid;neodymium;2-(propan-2-yldisulfanyl)propane.
What is the SMILES notation for hydrazinecarboxylic acid;neodymium;2-(propan-2-yldisulfanyl)propane?
The canonical SMILES for hydrazinecarboxylic acid;neodymium;2-(propan-2-yldisulfanyl)propane is CC(C)SSC(C)C.NNC(=O)O.[Nd].
What is the InChIKey of hydrazinecarboxylic acid;neodymium;2-(propan-2-yldisulfanyl)propane?
The InChIKey is HWOYACQEQVVIPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14S2.CH4N2O2.Nd/c1-5(2)7-8-6(3)4;2-3-1(4)5;/h5-6H,1-4H3;3H,2H2,(H,4,5);.
What are the key properties of hydrazinecarboxylic acid;neodymium;2-(propan-2-yldisulfanyl)propane?
hydrazinecarboxylic acid;neodymium;2-(propan-2-yldisulfanyl)propane has a molecular weight of 370.61 g/mol, XLogP of 2.31, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazinecarboxylic acid;neodymium;2-(propan-2-yldisulfanyl)propane is sourced from PubChem (CID 158608952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).