C4H9N3O3 — CID 90311881
[(2R)-1-hydrazinyl-1-oxopropan-2-yl]carbamic acid (PubChem CID 90311881) has the molecular formula C4H9N3O3 and a molecular weight of 147.13 g/mol. Its IUPAC name is [(2R)-1-hydrazinyl-1-oxopropan-2-yl]carbamic acid.
| Compound Name | [(2R)-1-hydrazinyl-1-oxopropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 90311881 |
| Molecular Formula | C4H9N3O3 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.06 |
| IUPAC Name | [(2R)-1-hydrazinyl-1-oxopropan-2-yl]carbamic acid |
| SMILES | C[C@@H](NC(=O)O)C(=O)NN |
| InChI | InChI=1S/C4H9N3O3/c1-2(3(8)7-5)6-4(9)10/h2,6H,5H2,1H3,(H,7,8)(H,9,10)/t2-/m1/s1 |
| InChIKey | QNLVZXDFMZCDMS-UWTATZPHSA-N |
| XLogP | -1.37 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|