C6H11FN2O3 — CID 90216384
[1-(2-fluoroethylamino)-1-oxopropan-2-yl]carbamic acid (PubChem CID 90216384) has the molecular formula C6H11FN2O3 and a molecular weight of 178.16 g/mol. Its IUPAC name is [1-(2-fluoroethylamino)-1-oxopropan-2-yl]carbamic acid.
| Compound Name | [1-(2-fluoroethylamino)-1-oxopropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 90216384 |
| Molecular Formula | C6H11FN2O3 |
| Molecular Weight | 178.16 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | [1-(2-fluoroethylamino)-1-oxopropan-2-yl]carbamic acid |
| SMILES | CC(NC(=O)O)C(=O)NCCF |
| InChI | InChI=1S/C6H11FN2O3/c1-4(9-6(11)12)5(10)8-3-2-7/h4,9H,2-3H2,1H3,(H,8,10)(H,11,12) |
| InChIKey | YLJDZQXQTJVQEE-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.16 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |