C7H13FN2O2 — CID 91190233
2-acetamido-N-(2-fluoroethyl)propanamide (PubChem CID 91190233) has the molecular formula C7H13FN2O2 and a molecular weight of 176.19 g/mol. Its IUPAC name is 2-acetamido-N-(2-fluoroethyl)propanamide.
| Compound Name | 2-acetamido-N-(2-fluoroethyl)propanamide |
|---|---|
| PubChem CID | 91190233 |
| Molecular Formula | C7H13FN2O2 |
| Molecular Weight | 176.19 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 2-acetamido-N-(2-fluoroethyl)propanamide |
| SMILES | CC(=O)NC(C)C(=O)NCCF |
| InChI | InChI=1S/C7H13FN2O2/c1-5(10-6(2)11)7(12)9-4-3-8/h5H,3-4H2,1-2H3,(H,9,12)(H,10,11) |
| InChIKey | JPTGALBWTJYNQW-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.19 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |