C11H22N2O2 — CID 134023295
2-acetamido-N-(4-methylpentyl)propanamide (PubChem CID 134023295) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 2-acetamido-N-(4-methylpentyl)propanamide.
| Compound Name | 2-acetamido-N-(4-methylpentyl)propanamide |
|---|---|
| PubChem CID | 134023295 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 2-acetamido-N-(4-methylpentyl)propanamide |
| SMILES | CC(=O)NC(C)C(=O)NCCCC(C)C |
| InChI | InChI=1S/C11H22N2O2/c1-8(2)6-5-7-12-11(15)9(3)13-10(4)14/h8-9H,5-7H2,1-4H3,(H,12,15)(H,13,14) |
| InChIKey | KWNDSSUWXAVFGV-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|