C12H24N2O2 — CID 162466533
2-acetamido-N-(4,4-dimethylpentyl)propanamide (PubChem CID 162466533) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-acetamido-N-(4,4-dimethylpentyl)propanamide.
| Compound Name | 2-acetamido-N-(4,4-dimethylpentyl)propanamide |
|---|---|
| PubChem CID | 162466533 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 2-acetamido-N-(4,4-dimethylpentyl)propanamide |
| SMILES | CC(=O)NC(C)C(=O)NCCCC(C)(C)C |
| InChI | InChI=1S/C12H24N2O2/c1-9(14-10(2)15)11(16)13-8-6-7-12(3,4)5/h9H,6-8H2,1-5H3,(H,13,16)(H,14,15) |
| InChIKey | IWEXKIPDTNKMEZ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|