C6H13N3O2 — CID 10464584
N-[(2S)-1-hydrazinyl-1-oxopropan-2-yl]propanamide (PubChem CID 10464584) has the molecular formula C6H13N3O2 and a molecular weight of 159.19 g/mol. Its IUPAC name is N-[(2S)-1-hydrazinyl-1-oxopropan-2-yl]propanamide.
| Compound Name | N-[(2S)-1-hydrazinyl-1-oxopropan-2-yl]propanamide |
|---|---|
| PubChem CID | 10464584 |
| Molecular Formula | C6H13N3O2 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | N-[(2S)-1-hydrazinyl-1-oxopropan-2-yl]propanamide |
| SMILES | CCC(=O)N[C@@H](C)C(=O)NN |
| InChI | InChI=1S/C6H13N3O2/c1-3-5(10)8-4(2)6(11)9-7/h4H,3,7H2,1-2H3,(H,8,10)(H,9,11)/t4-/m0/s1 |
| InChIKey | KTNAORZEQZDYHJ-BYPYZUCNSA-N |
| XLogP | -1.11 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|