About N-propan-2-ylpropanamide;dihydrochloride
N-propan-2-ylpropanamide;dihydrochloride (PubChem CID 172679019) has the molecular formula C6H15Cl2NO
and a molecular weight of 188.10 g/mol. Its IUPAC name is N-propan-2-ylpropanamide;dihydrochloride.
Molecular Properties
| Compound Name | N-propan-2-ylpropanamide;dihydrochloride |
| PubChem CID | 172679019 |
| Molecular Formula | C6H15Cl2NO |
| Molecular Weight | 188.10 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | N-propan-2-ylpropanamide;dihydrochloride |
| SMILES | CCC(=O)NC(C)C.Cl.Cl |
| InChI | InChI=1S/C6H13NO.2ClH/c1-4-6(8)7-5(2)3;;/h5H,4H2,1-3H3,(H,7,8);2*1H |
| InChIKey | ADFMGHVKKHSTFZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.10 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-propan-2-ylpropanamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propan-2-ylpropanamide;dihydrochloride?
The IUPAC name of N-propan-2-ylpropanamide;dihydrochloride (CID 172679019) is N-propan-2-ylpropanamide;dihydrochloride.
What is the SMILES notation for N-propan-2-ylpropanamide;dihydrochloride?
The canonical SMILES for N-propan-2-ylpropanamide;dihydrochloride is CCC(=O)NC(C)C.Cl.Cl.
What is the InChIKey of N-propan-2-ylpropanamide;dihydrochloride?
The InChIKey is ADFMGHVKKHSTFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO.2ClH/c1-4-6(8)7-5(2)3;;/h5H,4H2,1-3H3,(H,7,8);2*1H.
What are the key properties of N-propan-2-ylpropanamide;dihydrochloride?
N-propan-2-ylpropanamide;dihydrochloride has a molecular weight of 188.10 g/mol, XLogP of 1.76, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-propan-2-ylpropanamide;dihydrochloride is sourced from PubChem (CID 172679019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).