C10H20N2O3 — CID 142455323
3-hydroxy-2-(propanoylamino)-N-propan-2-ylbutanamide (PubChem CID 142455323) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is 3-hydroxy-2-(propanoylamino)-N-propan-2-ylbutanamide.
| Compound Name | 3-hydroxy-2-(propanoylamino)-N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 142455323 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 3-hydroxy-2-(propanoylamino)-N-propan-2-ylbutanamide |
| SMILES | CCC(=O)NC(C(=O)NC(C)C)C(C)O |
| InChI | InChI=1S/C10H20N2O3/c1-5-8(14)12-9(7(4)13)10(15)11-6(2)3/h6-7,9,13H,5H2,1-4H3,(H,11,15)(H,12,14) |
| InChIKey | XOFVZYMRYOUCJR-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |