About N-ethyl-2-methylpropanamide;methane;N-propan-2-ylpropanamide
N-ethyl-2-methylpropanamide;methane;N-propan-2-ylpropanamide (PubChem CID 160804032) has the molecular formula C13H30N2O2
and a molecular weight of 246.39 g/mol. Its IUPAC name is N-ethyl-2-methylpropanamide;methane;N-propan-2-ylpropanamide.
Molecular Properties
| Compound Name | N-ethyl-2-methylpropanamide;methane;N-propan-2-ylpropanamide |
| PubChem CID | 160804032 |
| Molecular Formula | C13H30N2O2 |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | N-ethyl-2-methylpropanamide;methane;N-propan-2-ylpropanamide |
| SMILES | C.CCC(=O)NC(C)C.CCNC(=O)C(C)C |
| InChI | InChI=1S/2C6H13NO.CH4/c1-4-7-6(8)5(2)3;1-4-6(8)7-5(2)3;/h2*5H,4H2,1-3H3,(H,7,8);1H4 |
| InChIKey | SDLKWDJYTRTAJB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-2-methylpropanamide;methane;N-propan-2-ylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-methylpropanamide;methane;N-propan-2-ylpropanamide?
The IUPAC name of N-ethyl-2-methylpropanamide;methane;N-propan-2-ylpropanamide (CID 160804032) is N-ethyl-2-methylpropanamide;methane;N-propan-2-ylpropanamide.
What is the SMILES notation for N-ethyl-2-methylpropanamide;methane;N-propan-2-ylpropanamide?
The canonical SMILES for N-ethyl-2-methylpropanamide;methane;N-propan-2-ylpropanamide is C.CCC(=O)NC(C)C.CCNC(=O)C(C)C.
What is the InChIKey of N-ethyl-2-methylpropanamide;methane;N-propan-2-ylpropanamide?
The InChIKey is SDLKWDJYTRTAJB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H13NO.CH4/c1-4-7-6(8)5(2)3;1-4-6(8)7-5(2)3;/h2*5H,4H2,1-3H3,(H,7,8);1H4.
What are the key properties of N-ethyl-2-methylpropanamide;methane;N-propan-2-ylpropanamide?
N-ethyl-2-methylpropanamide;methane;N-propan-2-ylpropanamide has a molecular weight of 246.39 g/mol, XLogP of 2.34, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-methylpropanamide;methane;N-propan-2-ylpropanamide is sourced from PubChem (CID 160804032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).