C14H26N2O2 — CID 15427851
(E)-3,4-dimethyl-5-(2-methylpropanoylamino)-N-propan-2-ylpent-3-enamide (PubChem CID 15427851) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is (E)-3,4-dimethyl-5-(2-methylpropanoylamino)-N-propan-2-ylpent-3-enamide.
| Compound Name | (E)-3,4-dimethyl-5-(2-methylpropanoylamino)-N-propan-2-ylpent-3-enamide |
|---|---|
| PubChem CID | 15427851 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | (E)-3,4-dimethyl-5-(2-methylpropanoylamino)-N-propan-2-ylpent-3-enamide |
| SMILES | C/C(CNC(=O)C(C)C)=C(/C)CC(=O)NC(C)C |
| InChI | InChI=1S/C14H26N2O2/c1-9(2)14(18)15-8-12(6)11(5)7-13(17)16-10(3)4/h9-10H,7-8H2,1-6H3,(H,15,18)(H,16,17)/b12-11+ |
| InChIKey | URXXZBWXKRVLTP-VAWYXSNFSA-N |
| XLogP | 2.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|