C13H28N2O2 — CID 158607783
N-ethyl-2-methylpropanamide;N-propan-2-ylbutanamide (PubChem CID 158607783) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is N-ethyl-2-methylpropanamide;N-propan-2-ylbutanamide.
| Compound Name | N-ethyl-2-methylpropanamide;N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 158607783 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | N-ethyl-2-methylpropanamide;N-propan-2-ylbutanamide |
| SMILES | CCCC(=O)NC(C)C.CCNC(=O)C(C)C |
| InChI | InChI=1S/C7H15NO.C6H13NO/c1-4-5-7(9)8-6(2)3;1-4-7-6(8)5(2)3/h6H,4-5H2,1-3H3,(H,8,9);5H,4H2,1-3H3,(H,7,8) |
| InChIKey | HWLJDTRHZMIHHT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |