molecular hydrogen;N-propan-2-ylpentanamide

C8H19NO — CID 167520420

IUPACmolecular hydrogen;N-propan-2-ylpentanamide
SMILESCCCCC(=O)NC(C)C.[H][H]
InChIInChI=1S/C8H17NO.H2/c1-4-5-6-8(10)9-7(2)3;/h7H,4-6H2,1-3H3,(H,9,10);1H
InChIKeyNFEPTTMJFGJCSF-UHFFFAOYSA-N
MW145.25 g/mol
LogP1.95
Rot. Bonds4

About molecular hydrogen;N-propan-2-ylpentanamide

molecular hydrogen;N-propan-2-ylpentanamide (PubChem CID 167520420) has the molecular formula C8H19NO and a molecular weight of 145.25 g/mol. Its IUPAC name is molecular hydrogen;N-propan-2-ylpentanamide.

Molecular Properties

Compound Namemolecular hydrogen;N-propan-2-ylpentanamide
PubChem CID167520420
Molecular FormulaC8H19NO
Molecular Weight145.25 g/mol
Exact Mass145.15
IUPAC Namemolecular hydrogen;N-propan-2-ylpentanamide
SMILESCCCCC(=O)NC(C)C.[H][H]
InChIInChI=1S/C8H17NO.H2/c1-4-5-6-8(10)9-7(2)3;/h7H,4-6H2,1-3H3,(H,9,10);1H
InChIKeyNFEPTTMJFGJCSF-UHFFFAOYSA-N
XLogP1.95
TPSA29.10 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500145.25
LogP ≤ 51.95
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze molecular hydrogen;N-propan-2-ylpentanamide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular hydrogen;N-propan-2-ylpentanamide?
The IUPAC name of molecular hydrogen;N-propan-2-ylpentanamide (CID 167520420) is molecular hydrogen;N-propan-2-ylpentanamide.
What is the SMILES notation for molecular hydrogen;N-propan-2-ylpentanamide?
The canonical SMILES for molecular hydrogen;N-propan-2-ylpentanamide is CCCCC(=O)NC(C)C.[H][H].
What is the InChIKey of molecular hydrogen;N-propan-2-ylpentanamide?
The InChIKey is NFEPTTMJFGJCSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO.H2/c1-4-5-6-8(10)9-7(2)3;/h7H,4-6H2,1-3H3,(H,9,10);1H.
What are the key properties of molecular hydrogen;N-propan-2-ylpentanamide?
molecular hydrogen;N-propan-2-ylpentanamide has a molecular weight of 145.25 g/mol, XLogP of 1.95, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;N-propan-2-ylpentanamide is sourced from PubChem (CID 167520420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).