About molecular hydrogen;N-propan-2-ylpentanamide
molecular hydrogen;N-propan-2-ylpentanamide (PubChem CID 167520420) has the molecular formula C8H19NO
and a molecular weight of 145.25 g/mol. Its IUPAC name is molecular hydrogen;N-propan-2-ylpentanamide.
Molecular Properties
| Compound Name | molecular hydrogen;N-propan-2-ylpentanamide |
| PubChem CID | 167520420 |
| Molecular Formula | C8H19NO |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.15 |
| IUPAC Name | molecular hydrogen;N-propan-2-ylpentanamide |
| SMILES | CCCCC(=O)NC(C)C.[H][H] |
| InChI | InChI=1S/C8H17NO.H2/c1-4-5-6-8(10)9-7(2)3;/h7H,4-6H2,1-3H3,(H,9,10);1H |
| InChIKey | NFEPTTMJFGJCSF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze molecular hydrogen;N-propan-2-ylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;N-propan-2-ylpentanamide?
The IUPAC name of molecular hydrogen;N-propan-2-ylpentanamide (CID 167520420) is molecular hydrogen;N-propan-2-ylpentanamide.
What is the SMILES notation for molecular hydrogen;N-propan-2-ylpentanamide?
The canonical SMILES for molecular hydrogen;N-propan-2-ylpentanamide is CCCCC(=O)NC(C)C.[H][H].
What is the InChIKey of molecular hydrogen;N-propan-2-ylpentanamide?
The InChIKey is NFEPTTMJFGJCSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO.H2/c1-4-5-6-8(10)9-7(2)3;/h7H,4-6H2,1-3H3,(H,9,10);1H.
What are the key properties of molecular hydrogen;N-propan-2-ylpentanamide?
molecular hydrogen;N-propan-2-ylpentanamide has a molecular weight of 145.25 g/mol, XLogP of 1.95, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;N-propan-2-ylpentanamide is sourced from PubChem (CID 167520420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).