molecular hydrogen;N-propan-2-ylhex-1-en-2-amine

C9H21N — CID 170740409

IUPACmolecular hydrogen;N-propan-2-ylhex-1-en-2-amine
SMILESC=C(CCCC)NC(C)C.[H][H]
InChIInChI=1S/C9H19N.H2/c1-5-6-7-9(4)10-8(2)3;/h8,10H,4-7H2,1-3H3;1H
InChIKeyQSBPMVHUCWNXNA-UHFFFAOYSA-N
MW143.27 g/mol
LogP2.93
Rot. Bonds5

About molecular hydrogen;N-propan-2-ylhex-1-en-2-amine

molecular hydrogen;N-propan-2-ylhex-1-en-2-amine (PubChem CID 170740409) has the molecular formula C9H21N and a molecular weight of 143.27 g/mol. Its IUPAC name is molecular hydrogen;N-propan-2-ylhex-1-en-2-amine.

Molecular Properties

Compound Namemolecular hydrogen;N-propan-2-ylhex-1-en-2-amine
PubChem CID170740409
Molecular FormulaC9H21N
Molecular Weight143.27 g/mol
Exact Mass143.17
IUPAC Namemolecular hydrogen;N-propan-2-ylhex-1-en-2-amine
SMILESC=C(CCCC)NC(C)C.[H][H]
InChIInChI=1S/C9H19N.H2/c1-5-6-7-9(4)10-8(2)3;/h8,10H,4-7H2,1-3H3;1H
InChIKeyQSBPMVHUCWNXNA-UHFFFAOYSA-N
XLogP2.93
TPSA12.03 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500143.27
LogP ≤ 52.93
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze molecular hydrogen;N-propan-2-ylhex-1-en-2-amine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular hydrogen;N-propan-2-ylhex-1-en-2-amine?
The IUPAC name of molecular hydrogen;N-propan-2-ylhex-1-en-2-amine (CID 170740409) is molecular hydrogen;N-propan-2-ylhex-1-en-2-amine.
What is the SMILES notation for molecular hydrogen;N-propan-2-ylhex-1-en-2-amine?
The canonical SMILES for molecular hydrogen;N-propan-2-ylhex-1-en-2-amine is C=C(CCCC)NC(C)C.[H][H].
What is the InChIKey of molecular hydrogen;N-propan-2-ylhex-1-en-2-amine?
The InChIKey is QSBPMVHUCWNXNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.H2/c1-5-6-7-9(4)10-8(2)3;/h8,10H,4-7H2,1-3H3;1H.
What are the key properties of molecular hydrogen;N-propan-2-ylhex-1-en-2-amine?
molecular hydrogen;N-propan-2-ylhex-1-en-2-amine has a molecular weight of 143.27 g/mol, XLogP of 2.93, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;N-propan-2-ylhex-1-en-2-amine is sourced from PubChem (CID 170740409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).