C12H23NO2 — CID 123525185
N-(5-methyl-2-oxohexan-3-yl)pentanamide (PubChem CID 123525185) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is N-(5-methyl-2-oxohexan-3-yl)pentanamide.
| Compound Name | N-(5-methyl-2-oxohexan-3-yl)pentanamide |
|---|---|
| PubChem CID | 123525185 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | N-(5-methyl-2-oxohexan-3-yl)pentanamide |
| SMILES | CCCCC(=O)NC(CC(C)C)C(C)=O |
| InChI | InChI=1S/C12H23NO2/c1-5-6-7-12(15)13-11(10(4)14)8-9(2)3/h9,11H,5-8H2,1-4H3,(H,13,15) |
| InChIKey | VPGVRSYSFZPQBD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |