C11H21NO3 — CID 170404242
4-hydroxy-N-(5-methyl-2-oxohexan-3-yl)butanamide (PubChem CID 170404242) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 4-hydroxy-N-(5-methyl-2-oxohexan-3-yl)butanamide.
| Compound Name | 4-hydroxy-N-(5-methyl-2-oxohexan-3-yl)butanamide |
|---|---|
| PubChem CID | 170404242 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 4-hydroxy-N-(5-methyl-2-oxohexan-3-yl)butanamide |
| SMILES | CC(=O)C(CC(C)C)NC(=O)CCCO |
| InChI | InChI=1S/C11H21NO3/c1-8(2)7-10(9(3)14)12-11(15)5-4-6-13/h8,10,13H,4-7H2,1-3H3,(H,12,15) |
| InChIKey | BLHZNSGAFQYWBR-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |