About ethane;N-propan-2-ylbutanamide
ethane;N-propan-2-ylbutanamide (PubChem CID 169175258) has the molecular formula C9H21NO
and a molecular weight of 159.27 g/mol. Its IUPAC name is ethane;N-propan-2-ylbutanamide.
Molecular Properties
| Compound Name | ethane;N-propan-2-ylbutanamide |
| PubChem CID | 169175258 |
| Molecular Formula | C9H21NO |
| Molecular Weight | 159.27 g/mol |
| Exact Mass | 159.16 |
| IUPAC Name | ethane;N-propan-2-ylbutanamide |
| SMILES | CC.CCCC(=O)NC(C)C |
| InChI | InChI=1S/C7H15NO.C2H6/c1-4-5-7(9)8-6(2)3;1-2/h6H,4-5H2,1-3H3,(H,8,9);1-2H3 |
| InChIKey | IVSUAXSSXHHFEL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;N-propan-2-ylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-propan-2-ylbutanamide?
The IUPAC name of ethane;N-propan-2-ylbutanamide (CID 169175258) is ethane;N-propan-2-ylbutanamide.
What is the SMILES notation for ethane;N-propan-2-ylbutanamide?
The canonical SMILES for ethane;N-propan-2-ylbutanamide is CC.CCCC(=O)NC(C)C.
What is the InChIKey of ethane;N-propan-2-ylbutanamide?
The InChIKey is IVSUAXSSXHHFEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO.C2H6/c1-4-5-7(9)8-6(2)3;1-2/h6H,4-5H2,1-3H3,(H,8,9);1-2H3.
What are the key properties of ethane;N-propan-2-ylbutanamide?
ethane;N-propan-2-ylbutanamide has a molecular weight of 159.27 g/mol, XLogP of 2.34, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-propan-2-ylbutanamide is sourced from PubChem (CID 169175258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).