C20H43N3O3 — CID 160609422
N-tert-butyl-2-methylpropanamide;bis(N-ethyl-2-methylpropanamide) (PubChem CID 160609422) has the molecular formula C20H43N3O3 and a molecular weight of 373.58 g/mol. Its IUPAC name is N-tert-butyl-2-methylpropanamide;bis(N-ethyl-2-methylpropanamide).
| Compound Name | N-tert-butyl-2-methylpropanamide;bis(N-ethyl-2-methylpropanamide) |
|---|---|
| PubChem CID | 160609422 |
| Molecular Formula | C20H43N3O3 |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.33 |
| IUPAC Name | N-tert-butyl-2-methylpropanamide;bis(N-ethyl-2-methylpropanamide) |
| SMILES | CC(C)C(=O)NC(C)(C)C.CCNC(=O)C(C)C.CCNC(=O)C(C)C |
| InChI | InChI=1S/C8H17NO.2C6H13NO/c1-6(2)7(10)9-8(3,4)5;2*1-4-7-6(8)5(2)3/h6H,1-5H3,(H,9,10);2*5H,4H2,1-3H3,(H,7,8) |
| InChIKey | RFHWOBDCEQSBMR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |