About N-ethyl-2-methylpropanamide;molecular hydrogen;prop-1-ene
N-ethyl-2-methylpropanamide;molecular hydrogen;prop-1-ene (PubChem CID 144853792) has the molecular formula C9H21NO
and a molecular weight of 159.27 g/mol. Its IUPAC name is N-ethyl-2-methylpropanamide;molecular hydrogen;prop-1-ene.
Molecular Properties
| Compound Name | N-ethyl-2-methylpropanamide;molecular hydrogen;prop-1-ene |
| PubChem CID | 144853792 |
| Molecular Formula | C9H21NO |
| Molecular Weight | 159.27 g/mol |
| Exact Mass | 159.16 |
| IUPAC Name | N-ethyl-2-methylpropanamide;molecular hydrogen;prop-1-ene |
| SMILES | C=CC.CCNC(=O)C(C)C.[H][H] |
| InChI | InChI=1S/C6H13NO.C3H6.H2/c1-4-7-6(8)5(2)3;1-3-2;/h5H,4H2,1-3H3,(H,7,8);3H,1H2,2H3;1H |
| InChIKey | HLCLJIKFKANXNC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-2-methylpropanamide;molecular hydrogen;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-methylpropanamide;molecular hydrogen;prop-1-ene?
The IUPAC name of N-ethyl-2-methylpropanamide;molecular hydrogen;prop-1-ene (CID 144853792) is N-ethyl-2-methylpropanamide;molecular hydrogen;prop-1-ene.
What is the SMILES notation for N-ethyl-2-methylpropanamide;molecular hydrogen;prop-1-ene?
The canonical SMILES for N-ethyl-2-methylpropanamide;molecular hydrogen;prop-1-ene is C=CC.CCNC(=O)C(C)C.[H][H].
What is the InChIKey of N-ethyl-2-methylpropanamide;molecular hydrogen;prop-1-ene?
The InChIKey is HLCLJIKFKANXNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO.C3H6.H2/c1-4-7-6(8)5(2)3;1-3-2;/h5H,4H2,1-3H3,(H,7,8);3H,1H2,2H3;1H.
What are the key properties of N-ethyl-2-methylpropanamide;molecular hydrogen;prop-1-ene?
N-ethyl-2-methylpropanamide;molecular hydrogen;prop-1-ene has a molecular weight of 159.27 g/mol, XLogP of 2.22, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-methylpropanamide;molecular hydrogen;prop-1-ene is sourced from PubChem (CID 144853792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).