C10H22N2O2S — CID 145330870
ethane;(2R)-N-[2-oxo-2-(propan-2-ylamino)ethyl]-2-sulfanylpropanamide (PubChem CID 145330870) has the molecular formula C10H22N2O2S and a molecular weight of 234.36 g/mol. Its IUPAC name is ethane;(2R)-N-[2-oxo-2-(propan-2-ylamino)ethyl]-2-sulfanylpropanamide.
| Compound Name | ethane;(2R)-N-[2-oxo-2-(propan-2-ylamino)ethyl]-2-sulfanylpropanamide |
|---|---|
| PubChem CID | 145330870 |
| Molecular Formula | C10H22N2O2S |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | ethane;(2R)-N-[2-oxo-2-(propan-2-ylamino)ethyl]-2-sulfanylpropanamide |
| SMILES | CC.CC(C)NC(=O)CNC(=O)[C@@H](C)S |
| InChI | InChI=1S/C8H16N2O2S.C2H6/c1-5(2)10-7(11)4-9-8(12)6(3)13;1-2/h5-6,13H,4H2,1-3H3,(H,9,12)(H,10,11);1-2H3/t6-;/m1./s1 |
| InChIKey | CNJMKXRHPNYJQS-FYZOBXCZSA-N |
| XLogP | 0.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|