C6H15ClN4O2 — CID 146675439
2-(hydrazinecarbonylamino)-N-propan-2-ylacetamide;hydrochloride (PubChem CID 146675439) has the molecular formula C6H15ClN4O2 and a molecular weight of 210.66 g/mol. Its IUPAC name is 2-(hydrazinecarbonylamino)-N-propan-2-ylacetamide;hydrochloride.
| Compound Name | 2-(hydrazinecarbonylamino)-N-propan-2-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 146675439 |
| Molecular Formula | C6H15ClN4O2 |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2-(hydrazinecarbonylamino)-N-propan-2-ylacetamide;hydrochloride |
| SMILES | CC(C)NC(=O)CNC(=O)NN.Cl |
| InChI | InChI=1S/C6H14N4O2.ClH/c1-4(2)9-5(11)3-8-6(12)10-7;/h4H,3,7H2,1-2H3,(H,9,11)(H2,8,10,12);1H |
| InChIKey | NJXOILUWMDLXSH-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|