C14H22N4O2 — CID 61341683
2-[[3-(1-aminoethyl)phenyl]carbamoylamino]-N-propan-2-ylacetamide (PubChem CID 61341683) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 2-[[3-(1-aminoethyl)phenyl]carbamoylamino]-N-propan-2-ylacetamide.
| Compound Name | 2-[[3-(1-aminoethyl)phenyl]carbamoylamino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 61341683 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 2-[[3-(1-aminoethyl)phenyl]carbamoylamino]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CNC(=O)Nc1cccc(C(C)N)c1 |
| InChI | InChI=1S/C14H22N4O2/c1-9(2)17-13(19)8-16-14(20)18-12-6-4-5-11(7-12)10(3)15/h4-7,9-10H,8,15H2,1-3H3,(H,17,19)(H2,16,18,20) |
| InChIKey | CMRYUMOPRJJRDI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |