C16H27N3O — CID 83147014
1-[3-(1-aminoethyl)phenyl]-3-(2,3,3-trimethylbutyl)urea (PubChem CID 83147014) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is 1-[3-(1-aminoethyl)phenyl]-3-(2,3,3-trimethylbutyl)urea.
| Compound Name | 1-[3-(1-aminoethyl)phenyl]-3-(2,3,3-trimethylbutyl)urea |
|---|---|
| PubChem CID | 83147014 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | 1-[3-(1-aminoethyl)phenyl]-3-(2,3,3-trimethylbutyl)urea |
| SMILES | CC(N)c1cccc(NC(=O)NCC(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C16H27N3O/c1-11(16(3,4)5)10-18-15(20)19-14-8-6-7-13(9-14)12(2)17/h6-9,11-12H,10,17H2,1-5H3,(H2,18,19,20) |
| InChIKey | BIIXFUVJRYUJAP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |