C11H22N4O4 — CID 112547146
tert-butyl N-[[2-oxo-2-(propan-2-ylamino)ethyl]carbamoylamino]carbamate (PubChem CID 112547146) has the molecular formula C11H22N4O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is tert-butyl N-[[2-oxo-2-(propan-2-ylamino)ethyl]carbamoylamino]carbamate.
| Compound Name | tert-butyl N-[[2-oxo-2-(propan-2-ylamino)ethyl]carbamoylamino]carbamate |
|---|---|
| PubChem CID | 112547146 |
| Molecular Formula | C11H22N4O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | tert-butyl N-[[2-oxo-2-(propan-2-ylamino)ethyl]carbamoylamino]carbamate |
| SMILES | CC(C)NC(=O)CNC(=O)NNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H22N4O4/c1-7(2)13-8(16)6-12-9(17)14-15-10(18)19-11(3,4)5/h7H,6H2,1-5H3,(H,13,16)(H,15,18)(H2,12,14,17) |
| InChIKey | NTSLLQJJAIPTLO-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|