C10H19N3O4S — CID 11161731
tert-butyl N-[2-[[(2R)-1-amino-1-oxo-3-sulfanylpropan-2-yl]amino]-2-oxoethyl]carbamate (PubChem CID 11161731) has the molecular formula C10H19N3O4S and a molecular weight of 277.35 g/mol. Its IUPAC name is tert-butyl N-[2-[[(2R)-1-amino-1-oxo-3-sulfanylpropan-2-yl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(2R)-1-amino-1-oxo-3-sulfanylpropan-2-yl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 11161731 |
| Molecular Formula | C10H19N3O4S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | tert-butyl N-[2-[[(2R)-1-amino-1-oxo-3-sulfanylpropan-2-yl]amino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)N[C@@H](CS)C(N)=O |
| InChI | InChI=1S/C10H19N3O4S/c1-10(2,3)17-9(16)12-4-7(14)13-6(5-18)8(11)15/h6,18H,4-5H2,1-3H3,(H2,11,15)(H,12,16)(H,13,14)/t6-/m0/s1 |
| InChIKey | CBNHDJLOSDALMJ-LURJTMIESA-N |
| XLogP | -0.59 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|