C12H23N3O4S — CID 162409667
tert-butyl N-[2-[[(2R)-1-amino-1-oxo-3-sulfanylpropan-2-yl]-ethylamino]-2-oxoethyl]carbamate (PubChem CID 162409667) has the molecular formula C12H23N3O4S and a molecular weight of 305.40 g/mol. Its IUPAC name is tert-butyl N-[2-[[(2R)-1-amino-1-oxo-3-sulfanylpropan-2-yl]-ethylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(2R)-1-amino-1-oxo-3-sulfanylpropan-2-yl]-ethylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 162409667 |
| Molecular Formula | C12H23N3O4S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | tert-butyl N-[2-[[(2R)-1-amino-1-oxo-3-sulfanylpropan-2-yl]-ethylamino]-2-oxoethyl]carbamate |
| SMILES | CCN(C(=O)CNC(=O)OC(C)(C)C)[C@@H](CS)C(N)=O |
| InChI | InChI=1S/C12H23N3O4S/c1-5-15(8(7-20)10(13)17)9(16)6-14-11(18)19-12(2,3)4/h8,20H,5-7H2,1-4H3,(H2,13,17)(H,14,18)/t8-/m0/s1 |
| InChIKey | MSVXKAUISYEUAM-QMMMGPOBSA-N |
| XLogP | 0.14 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|