C11H22N2O5 — CID 127108190
tert-butyl N-[2-[bis(2-hydroxyethyl)amino]-2-oxoethyl]carbamate (PubChem CID 127108190) has the molecular formula C11H22N2O5 and a molecular weight of 262.31 g/mol. Its IUPAC name is tert-butyl N-[2-[bis(2-hydroxyethyl)amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[bis(2-hydroxyethyl)amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 127108190 |
| Molecular Formula | C11H22N2O5 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | tert-butyl N-[2-[bis(2-hydroxyethyl)amino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)N(CCO)CCO |
| InChI | InChI=1S/C11H22N2O5/c1-11(2,3)18-10(17)12-8-9(16)13(4-6-14)5-7-15/h14-15H,4-8H2,1-3H3,(H,12,17) |
| InChIKey | RXGRCQGNDXJFLA-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |