C35H40N2O3P2 — CID 148691344
tert-butyl N-[2-[bis(2-diphenylphosphanylethyl)amino]-2-oxoethyl]carbamate (PubChem CID 148691344) has the molecular formula C35H40N2O3P2 and a molecular weight of 598.66 g/mol. Its IUPAC name is tert-butyl N-[2-[bis(2-diphenylphosphanylethyl)amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[bis(2-diphenylphosphanylethyl)amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 148691344 |
| Molecular Formula | C35H40N2O3P2 |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.25 |
| IUPAC Name | tert-butyl N-[2-[bis(2-diphenylphosphanylethyl)amino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)N(CCP(c1ccccc1)c1ccccc1)CCP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H40N2O3P2/c1-35(2,3)40-34(39)36-28-33(38)37(24-26-41(29-16-8-4-9-17-29)30-18-10-5-11-19-30)25-27-42(31-20-12-6-13-21-31)32-22-14-7-15-23-32/h4-23H,24-28H2,1-3H3,(H,36,39) |
| InChIKey | NTNOPTWAZFLHGE-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|