C16H23N3O4 — CID 69441199
tert-butyl N-[2-[N-(dimethylcarbamoyl)anilino]-2-oxoethyl]carbamate (PubChem CID 69441199) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is tert-butyl N-[2-[N-(dimethylcarbamoyl)anilino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[N-(dimethylcarbamoyl)anilino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 69441199 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | tert-butyl N-[2-[N-(dimethylcarbamoyl)anilino]-2-oxoethyl]carbamate |
| SMILES | CN(C)C(=O)N(C(=O)CNC(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C16H23N3O4/c1-16(2,3)23-14(21)17-11-13(20)19(15(22)18(4)5)12-9-7-6-8-10-12/h6-10H,11H2,1-5H3,(H,17,21) |
| InChIKey | COAFNKWSSHRGFS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |