C11H19N3O6 — CID 87358722
2-[2-ethyl-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]hydrazinyl]-2-oxoacetic acid (PubChem CID 87358722) has the molecular formula C11H19N3O6 and a molecular weight of 289.29 g/mol. Its IUPAC name is 2-[2-ethyl-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]hydrazinyl]-2-oxoacetic acid.
| Compound Name | 2-[2-ethyl-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]hydrazinyl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 87358722 |
| Molecular Formula | C11H19N3O6 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-[2-ethyl-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]hydrazinyl]-2-oxoacetic acid |
| SMILES | CCN(NC(=O)C(=O)O)C(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H19N3O6/c1-5-14(13-8(16)9(17)18)7(15)6-12-10(19)20-11(2,3)4/h5-6H2,1-4H3,(H,12,19)(H,13,16)(H,17,18) |
| InChIKey | MBTSFLQIPIEUCL-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|