C8H16N4O3S — CID 142158613
2-[[2-[[2-(methylamino)acetyl]amino]acetyl]amino]-3-sulfanylpropanamide (PubChem CID 142158613) has the molecular formula C8H16N4O3S and a molecular weight of 248.31 g/mol. Its IUPAC name is 2-[[2-[[2-(methylamino)acetyl]amino]acetyl]amino]-3-sulfanylpropanamide.
| Compound Name | 2-[[2-[[2-(methylamino)acetyl]amino]acetyl]amino]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 142158613 |
| Molecular Formula | C8H16N4O3S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 2-[[2-[[2-(methylamino)acetyl]amino]acetyl]amino]-3-sulfanylpropanamide |
| SMILES | CNCC(=O)NCC(=O)NC(CS)C(N)=O |
| InChI | InChI=1S/C8H16N4O3S/c1-10-2-6(13)11-3-7(14)12-5(4-16)8(9)15/h5,10,16H,2-4H2,1H3,(H2,9,15)(H,11,13)(H,12,14) |
| InChIKey | QCWJUNIUWDGGFZ-UHFFFAOYSA-N |
| XLogP | -2.78 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|