C11H19N3O6 — CID 147834087
2-[[2-[[2-(methylamino)acetyl]amino]acetyl]amino]hexanedioic acid (PubChem CID 147834087) has the molecular formula C11H19N3O6 and a molecular weight of 289.29 g/mol. Its IUPAC name is 2-[[2-[[2-(methylamino)acetyl]amino]acetyl]amino]hexanedioic acid.
| Compound Name | 2-[[2-[[2-(methylamino)acetyl]amino]acetyl]amino]hexanedioic acid |
|---|---|
| PubChem CID | 147834087 |
| Molecular Formula | C11H19N3O6 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-[[2-[[2-(methylamino)acetyl]amino]acetyl]amino]hexanedioic acid |
| SMILES | CNCC(=O)NCC(=O)NC(CCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H19N3O6/c1-12-5-8(15)13-6-9(16)14-7(11(19)20)3-2-4-10(17)18/h7,12H,2-6H2,1H3,(H,13,15)(H,14,16)(H,17,18)(H,19,20) |
| InChIKey | HRRAPSSXDHTINT-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |