C9H23N3O2 — CID 168928174
ethane;2-[[2-(methylamino)acetyl]amino]acetamide (PubChem CID 168928174) has the molecular formula C9H23N3O2 and a molecular weight of 205.30 g/mol. Its IUPAC name is ethane;2-[[2-(methylamino)acetyl]amino]acetamide.
| Compound Name | ethane;2-[[2-(methylamino)acetyl]amino]acetamide |
|---|---|
| PubChem CID | 168928174 |
| Molecular Formula | C9H23N3O2 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | ethane;2-[[2-(methylamino)acetyl]amino]acetamide |
| SMILES | CC.CC.CNCC(=O)NCC(N)=O |
| InChI | InChI=1S/C5H11N3O2.2C2H6/c1-7-3-5(10)8-2-4(6)9;2*1-2/h7H,2-3H2,1H3,(H2,6,9)(H,8,10);2*1-2H3 |
| InChIKey | ZSMCESVZZTUEEY-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |