C6H15N3O3 — CID 143571891
2-acetamidoacetamide;methylaminomethanol (PubChem CID 143571891) has the molecular formula C6H15N3O3 and a molecular weight of 177.20 g/mol. Its IUPAC name is 2-acetamidoacetamide;methylaminomethanol.
| Compound Name | 2-acetamidoacetamide;methylaminomethanol |
|---|---|
| PubChem CID | 143571891 |
| Molecular Formula | C6H15N3O3 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.11 |
| IUPAC Name | 2-acetamidoacetamide;methylaminomethanol |
| SMILES | CC(=O)NCC(N)=O.CNCO |
| InChI | InChI=1S/C4H8N2O2.C2H7NO/c1-3(7)6-2-4(5)8;1-3-2-4/h2H2,1H3,(H2,5,8)(H,6,7);3-4H,2H2,1H3 |
| InChIKey | UOKSVPMAIXIPDP-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|