About 2-acetamidoacetamide;methylaminomethanol
2-acetamidoacetamide;methylaminomethanol (PubChem CID 143571891) has the molecular formula C6H15N3O3
and a molecular weight of 177.20 g/mol. Its IUPAC name is 2-acetamidoacetamide;methylaminomethanol.
Molecular Properties
| Compound Name | 2-acetamidoacetamide;methylaminomethanol |
| PubChem CID | 143571891 |
| Molecular Formula | C6H15N3O3 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.11 |
| IUPAC Name | 2-acetamidoacetamide;methylaminomethanol |
| SMILES | CC(=O)NCC(N)=O.CNCO |
| InChI | InChI=1S/C4H8N2O2.C2H7NO/c1-3(7)6-2-4(5)8;1-3-2-4/h2H2,1H3,(H2,5,8)(H,6,7);3-4H,2H2,1H3 |
| InChIKey | UOKSVPMAIXIPDP-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-acetamidoacetamide;methylaminomethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamidoacetamide;methylaminomethanol?
The IUPAC name of 2-acetamidoacetamide;methylaminomethanol (CID 143571891) is 2-acetamidoacetamide;methylaminomethanol.
What is the SMILES notation for 2-acetamidoacetamide;methylaminomethanol?
The canonical SMILES for 2-acetamidoacetamide;methylaminomethanol is CC(=O)NCC(N)=O.CNCO.
What is the InChIKey of 2-acetamidoacetamide;methylaminomethanol?
The InChIKey is UOKSVPMAIXIPDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O2.C2H7NO/c1-3(7)6-2-4(5)8;1-3-2-4/h2H2,1H3,(H2,5,8)(H,6,7);3-4H,2H2,1H3.
What are the key properties of 2-acetamidoacetamide;methylaminomethanol?
2-acetamidoacetamide;methylaminomethanol has a molecular weight of 177.20 g/mol, XLogP of -2.24, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamidoacetamide;methylaminomethanol is sourced from PubChem (CID 143571891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).