C7H14N2O3 — CID 22182173
2-(methylamino)acetamide;2-methylprop-2-enoic acid (PubChem CID 22182173) has the molecular formula C7H14N2O3 and a molecular weight of 174.20 g/mol. Its IUPAC name is 2-(methylamino)acetamide;2-methylprop-2-enoic acid.
| Compound Name | 2-(methylamino)acetamide;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 22182173 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 2-(methylamino)acetamide;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.CNCC(N)=O |
| InChI | InChI=1S/C4H6O2.C3H8N2O/c1-3(2)4(5)6;1-5-2-3(4)6/h1H2,2H3,(H,5,6);5H,2H2,1H3,(H2,4,6) |
| InChIKey | VOVCGZDXKZKHEM-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|