About N-methylmethanamine;bis(2-methylprop-2-enoic acid)
N-methylmethanamine;bis(2-methylprop-2-enoic acid) (PubChem CID 175091080) has the molecular formula C10H19NO4
and a molecular weight of 217.26 g/mol. Its IUPAC name is N-methylmethanamine;bis(2-methylprop-2-enoic acid).
Molecular Properties
| Compound Name | N-methylmethanamine;bis(2-methylprop-2-enoic acid) |
| PubChem CID | 175091080 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | N-methylmethanamine;bis(2-methylprop-2-enoic acid) |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.CNC |
| InChI | InChI=1S/2C4H6O2.C2H7N/c2*1-3(2)4(5)6;1-3-2/h2*1H2,2H3,(H,5,6);3H,1-2H3 |
| InChIKey | PCSTYTBAEBLDSG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-methylmethanamine;bis(2-methylprop-2-enoic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylmethanamine;bis(2-methylprop-2-enoic acid)?
The IUPAC name of N-methylmethanamine;bis(2-methylprop-2-enoic acid) (CID 175091080) is N-methylmethanamine;bis(2-methylprop-2-enoic acid).
What is the SMILES notation for N-methylmethanamine;bis(2-methylprop-2-enoic acid)?
The canonical SMILES for N-methylmethanamine;bis(2-methylprop-2-enoic acid) is C=C(C)C(=O)O.C=C(C)C(=O)O.CNC.
What is the InChIKey of N-methylmethanamine;bis(2-methylprop-2-enoic acid)?
The InChIKey is PCSTYTBAEBLDSG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H6O2.C2H7N/c2*1-3(2)4(5)6;1-3-2/h2*1H2,2H3,(H,5,6);3H,1-2H3.
What are the key properties of N-methylmethanamine;bis(2-methylprop-2-enoic acid)?
N-methylmethanamine;bis(2-methylprop-2-enoic acid) has a molecular weight of 217.26 g/mol, XLogP of 1.13, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylmethanamine;bis(2-methylprop-2-enoic acid) is sourced from PubChem (CID 175091080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).