About 2-acetamidoacetate;chromium(3+)
2-acetamidoacetate;chromium(3+) (PubChem CID 161474806) has the molecular formula C4H6CrNO3+2
and a molecular weight of 168.09 g/mol. Its IUPAC name is 2-acetamidoacetate;chromium(3+).
Molecular Properties
| Compound Name | 2-acetamidoacetate;chromium(3+) |
| PubChem CID | 161474806 |
| Molecular Formula | C4H6CrNO3+2 |
| Molecular Weight | 168.09 g/mol |
| Exact Mass | 167.97 |
| IUPAC Name | 2-acetamidoacetate;chromium(3+) |
| SMILES | CC(=O)NCC(=O)[O-].[Cr+3] |
| InChI | InChI=1S/C4H7NO3.Cr/c1-3(6)5-2-4(7)8;/h2H2,1H3,(H,5,6)(H,7,8);/q;+3/p-1 |
| InChIKey | WDOMRKMDNFBJJB-UHFFFAOYSA-M |
| XLogP | -2.13 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.09 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-acetamidoacetate;chromium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamidoacetate;chromium(3+)?
The IUPAC name of 2-acetamidoacetate;chromium(3+) (CID 161474806) is 2-acetamidoacetate;chromium(3+).
What is the SMILES notation for 2-acetamidoacetate;chromium(3+)?
The canonical SMILES for 2-acetamidoacetate;chromium(3+) is CC(=O)NCC(=O)[O-].[Cr+3].
What is the InChIKey of 2-acetamidoacetate;chromium(3+)?
The InChIKey is WDOMRKMDNFBJJB-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H7NO3.Cr/c1-3(6)5-2-4(7)8;/h2H2,1H3,(H,5,6)(H,7,8);/q;+3/p-1.
What are the key properties of 2-acetamidoacetate;chromium(3+)?
2-acetamidoacetate;chromium(3+) has a molecular weight of 168.09 g/mol, XLogP of -2.13, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamidoacetate;chromium(3+) is sourced from PubChem (CID 161474806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).