About sodium 2-(carboxyamino)acetate
sodium 2-(carboxyamino)acetate (PubChem CID 58758121) has the molecular formula C3H4NNaO4
and a molecular weight of 141.06 g/mol. Its IUPAC name is sodium 2-(carboxyamino)acetate.
Molecular Properties
| Compound Name | sodium 2-(carboxyamino)acetate |
| PubChem CID | 58758121 |
| Molecular Formula | C3H4NNaO4 |
| Molecular Weight | 141.06 g/mol |
| Exact Mass | 141.00 |
| IUPAC Name | sodium 2-(carboxyamino)acetate |
| SMILES | O=C([O-])CNC(=O)O.[Na+] |
| InChI | InChI=1S/C3H5NO4.Na/c5-2(6)1-4-3(7)8;/h4H,1H2,(H,5,6)(H,7,8);/q;+1/p-1 |
| InChIKey | JXGXWRMYCMJHQT-UHFFFAOYSA-M |
| XLogP | -4.99 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.06 |
| LogP ≤ 5 | -4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium 2-(carboxyamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-(carboxyamino)acetate?
The IUPAC name of sodium 2-(carboxyamino)acetate (CID 58758121) is sodium 2-(carboxyamino)acetate.
What is the SMILES notation for sodium 2-(carboxyamino)acetate?
The canonical SMILES for sodium 2-(carboxyamino)acetate is O=C([O-])CNC(=O)O.[Na+].
What is the InChIKey of sodium 2-(carboxyamino)acetate?
The InChIKey is JXGXWRMYCMJHQT-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H5NO4.Na/c5-2(6)1-4-3(7)8;/h4H,1H2,(H,5,6)(H,7,8);/q;+1/p-1.
What are the key properties of sodium 2-(carboxyamino)acetate?
sodium 2-(carboxyamino)acetate has a molecular weight of 141.06 g/mol, XLogP of -4.99, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-(carboxyamino)acetate is sourced from PubChem (CID 58758121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).