sodium 2-(carboxyamino)acetate

C3H4NNaO4 — CID 58758121

IUPACsodium 2-(carboxyamino)acetate
SMILESO=C([O-])CNC(=O)O.[Na+]
InChIInChI=1S/C3H5NO4.Na/c5-2(6)1-4-3(7)8;/h4H,1H2,(H,5,6)(H,7,8);/q;+1/p-1
InChIKeyJXGXWRMYCMJHQT-UHFFFAOYSA-M
MW141.06 g/mol
LogP-4.99
Rot. Bonds2

About sodium 2-(carboxyamino)acetate

sodium 2-(carboxyamino)acetate (PubChem CID 58758121) has the molecular formula C3H4NNaO4 and a molecular weight of 141.06 g/mol. Its IUPAC name is sodium 2-(carboxyamino)acetate.

Molecular Properties

Compound Namesodium 2-(carboxyamino)acetate
PubChem CID58758121
Molecular FormulaC3H4NNaO4
Molecular Weight141.06 g/mol
Exact Mass141.00
IUPAC Namesodium 2-(carboxyamino)acetate
SMILESO=C([O-])CNC(=O)O.[Na+]
InChIInChI=1S/C3H5NO4.Na/c5-2(6)1-4-3(7)8;/h4H,1H2,(H,5,6)(H,7,8);/q;+1/p-1
InChIKeyJXGXWRMYCMJHQT-UHFFFAOYSA-M
XLogP-4.99
TPSA89.46 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500141.06
LogP ≤ 5-4.99
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze sodium 2-(carboxyamino)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 2-(carboxyamino)acetate?
The IUPAC name of sodium 2-(carboxyamino)acetate (CID 58758121) is sodium 2-(carboxyamino)acetate.
What is the SMILES notation for sodium 2-(carboxyamino)acetate?
The canonical SMILES for sodium 2-(carboxyamino)acetate is O=C([O-])CNC(=O)O.[Na+].
What is the InChIKey of sodium 2-(carboxyamino)acetate?
The InChIKey is JXGXWRMYCMJHQT-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H5NO4.Na/c5-2(6)1-4-3(7)8;/h4H,1H2,(H,5,6)(H,7,8);/q;+1/p-1.
What are the key properties of sodium 2-(carboxyamino)acetate?
sodium 2-(carboxyamino)acetate has a molecular weight of 141.06 g/mol, XLogP of -4.99, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-(carboxyamino)acetate is sourced from PubChem (CID 58758121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).