C6H8N2Na2O6 — CID 141044927
disodium;2-[(carboxyamino)methyl-(carboxylatomethyl)amino]acetate (PubChem CID 141044927) has the molecular formula C6H8N2Na2O6 and a molecular weight of 250.12 g/mol. Its IUPAC name is disodium;2-[(carboxyamino)methyl-(carboxylatomethyl)amino]acetate.
| Compound Name | disodium;2-[(carboxyamino)methyl-(carboxylatomethyl)amino]acetate |
|---|---|
| PubChem CID | 141044927 |
| Molecular Formula | C6H8N2Na2O6 |
| Molecular Weight | 250.12 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | disodium;2-[(carboxyamino)methyl-(carboxylatomethyl)amino]acetate |
| SMILES | O=C([O-])CN(CNC(=O)O)CC(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C6H10N2O6.2Na/c9-4(10)1-8(2-5(11)12)3-7-6(13)14;;/h7H,1-3H2,(H,9,10)(H,11,12)(H,13,14);;/q;2*+1/p-2 |
| InChIKey | WDTPKEPMHUWICM-UHFFFAOYSA-L |
| XLogP | -9.98 |
| TPSA | 132.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.12 |
| LogP ≤ 5 | -9.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|