About diazanium;2-(carboxylatomethylamino)acetate
diazanium;2-(carboxylatomethylamino)acetate (PubChem CID 18769481) has the molecular formula C4H13N3O4
and a molecular weight of 167.16 g/mol. Its IUPAC name is diazanium;2-(carboxylatomethylamino)acetate.
Molecular Properties
| Compound Name | diazanium;2-(carboxylatomethylamino)acetate |
| PubChem CID | 18769481 |
| Molecular Formula | C4H13N3O4 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | diazanium;2-(carboxylatomethylamino)acetate |
| SMILES | O=C([O-])CNCC(=O)[O-].[NH4+].[NH4+] |
| InChI | InChI=1S/C4H7NO4.2H3N/c6-3(7)1-5-2-4(8)9;;/h5H,1-2H2,(H,6,7)(H,8,9);2*1H3 |
| InChIKey | OEDPMSDASHAOCT-UHFFFAOYSA-N |
| XLogP | -3.17 |
| TPSA | 165.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze diazanium;2-(carboxylatomethylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazanium;2-(carboxylatomethylamino)acetate?
The IUPAC name of diazanium;2-(carboxylatomethylamino)acetate (CID 18769481) is diazanium;2-(carboxylatomethylamino)acetate.
What is the SMILES notation for diazanium;2-(carboxylatomethylamino)acetate?
The canonical SMILES for diazanium;2-(carboxylatomethylamino)acetate is O=C([O-])CNCC(=O)[O-].[NH4+].[NH4+].
What is the InChIKey of diazanium;2-(carboxylatomethylamino)acetate?
The InChIKey is OEDPMSDASHAOCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO4.2H3N/c6-3(7)1-5-2-4(8)9;;/h5H,1-2H2,(H,6,7)(H,8,9);2*1H3.
What are the key properties of diazanium;2-(carboxylatomethylamino)acetate?
diazanium;2-(carboxylatomethylamino)acetate has a molecular weight of 167.16 g/mol, XLogP of -3.17, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diazanium;2-(carboxylatomethylamino)acetate is sourced from PubChem (CID 18769481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).