C10H33N8NaO2 — CID 23701740
sodium;2-(2-aminoethylamino)acetate;tris(ethane-1,2-diamine) (PubChem CID 23701740) has the molecular formula C10H33N8NaO2 and a molecular weight of 320.42 g/mol. Its IUPAC name is sodium;2-(2-aminoethylamino)acetate;tris(ethane-1,2-diamine).
| Compound Name | sodium;2-(2-aminoethylamino)acetate;tris(ethane-1,2-diamine) |
|---|---|
| PubChem CID | 23701740 |
| Molecular Formula | C10H33N8NaO2 |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.26 |
| IUPAC Name | sodium;2-(2-aminoethylamino)acetate;tris(ethane-1,2-diamine) |
| SMILES | NCCN.NCCN.NCCN.NCCNCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C4H10N2O2.3C2H8N2.Na/c5-1-2-6-3-4(7)8;3*3-1-2-4;/h6H,1-3,5H2,(H,7,8);3*1-4H2;/q;;;;+1/p-1 |
| InChIKey | JEOUGKXYMWFKNS-UHFFFAOYSA-M |
| XLogP | -9.00 |
| TPSA | 234.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | -9.00 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|