C6H12N2O2 — CID 57071284
1-(2-aminoethylamino)butane-2,3-dione (PubChem CID 57071284) has the molecular formula C6H12N2O2 and a molecular weight of 144.17 g/mol. Its IUPAC name is 1-(2-aminoethylamino)butane-2,3-dione.
| Compound Name | 1-(2-aminoethylamino)butane-2,3-dione |
|---|---|
| PubChem CID | 57071284 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 1-(2-aminoethylamino)butane-2,3-dione |
| SMILES | CC(=O)C(=O)CNCCN |
| InChI | InChI=1S/C6H12N2O2/c1-5(9)6(10)4-8-3-2-7/h8H,2-4,7H2,1H3 |
| InChIKey | SCVRDSQGNSBARF-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|