About lead(2+);bis(2-(2-oxopropylamino)acetate)
lead(2+);bis(2-(2-oxopropylamino)acetate) (PubChem CID 87752603) has the molecular formula C10H16N2O6Pb
and a molecular weight of 467.45 g/mol. Its IUPAC name is lead(2+);bis(2-(2-oxopropylamino)acetate).
Molecular Properties
| Compound Name | lead(2+);bis(2-(2-oxopropylamino)acetate) |
| PubChem CID | 87752603 |
| Molecular Formula | C10H16N2O6Pb |
| Molecular Weight | 467.45 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | lead(2+);bis(2-(2-oxopropylamino)acetate) |
| SMILES | CC(=O)CNCC(=O)[O-].CC(=O)CNCC(=O)[O-].[Pb+2] |
| InChI | InChI=1S/2C5H9NO3.Pb/c2*1-4(7)2-6-3-5(8)9;/h2*6H,2-3H2,1H3,(H,8,9);/q;;+2/p-2 |
| InChIKey | FHSOIRVOPQMUMO-UHFFFAOYSA-L |
| XLogP | -4.55 |
| TPSA | 138.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.45 |
| LogP ≤ 5 | -4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze lead(2+);bis(2-(2-oxopropylamino)acetate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lead(2+);bis(2-(2-oxopropylamino)acetate)?
The IUPAC name of lead(2+);bis(2-(2-oxopropylamino)acetate) (CID 87752603) is lead(2+);bis(2-(2-oxopropylamino)acetate).
What is the SMILES notation for lead(2+);bis(2-(2-oxopropylamino)acetate)?
The canonical SMILES for lead(2+);bis(2-(2-oxopropylamino)acetate) is CC(=O)CNCC(=O)[O-].CC(=O)CNCC(=O)[O-].[Pb+2].
What is the InChIKey of lead(2+);bis(2-(2-oxopropylamino)acetate)?
The InChIKey is FHSOIRVOPQMUMO-UHFFFAOYSA-L. The full InChI is InChI=1S/2C5H9NO3.Pb/c2*1-4(7)2-6-3-5(8)9;/h2*6H,2-3H2,1H3,(H,8,9);/q;;+2/p-2.
What are the key properties of lead(2+);bis(2-(2-oxopropylamino)acetate)?
lead(2+);bis(2-(2-oxopropylamino)acetate) has a molecular weight of 467.45 g/mol, XLogP of -4.55, 8 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for lead(2+);bis(2-(2-oxopropylamino)acetate) is sourced from PubChem (CID 87752603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).