About 2-oxobutylcarbamic acid
2-oxobutylcarbamic acid (PubChem CID 87278919) has the molecular formula C5H9NO3
and a molecular weight of 131.13 g/mol. Its IUPAC name is 2-oxobutylcarbamic acid.
Molecular Properties
| Compound Name | 2-oxobutylcarbamic acid |
| PubChem CID | 87278919 |
| Molecular Formula | C5H9NO3 |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.06 |
| IUPAC Name | 2-oxobutylcarbamic acid |
| SMILES | CCC(=O)CNC(=O)O |
| InChI | InChI=1S/C5H9NO3/c1-2-4(7)3-6-5(8)9/h6H,2-3H2,1H3,(H,8,9) |
| InChIKey | FQVWMXMEOIYZDZ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-oxobutylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxobutylcarbamic acid?
The IUPAC name of 2-oxobutylcarbamic acid (CID 87278919) is 2-oxobutylcarbamic acid.
What is the SMILES notation for 2-oxobutylcarbamic acid?
The canonical SMILES for 2-oxobutylcarbamic acid is CCC(=O)CNC(=O)O.
What is the InChIKey of 2-oxobutylcarbamic acid?
The InChIKey is FQVWMXMEOIYZDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO3/c1-2-4(7)3-6-5(8)9/h6H,2-3H2,1H3,(H,8,9).
What are the key properties of 2-oxobutylcarbamic acid?
2-oxobutylcarbamic acid has a molecular weight of 131.13 g/mol, XLogP of 0.23, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxobutylcarbamic acid is sourced from PubChem (CID 87278919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).