hydrogen peroxide;pentan-3-one

C5H12O3 — CID 18361632

IUPAChydrogen peroxide;pentan-3-one
SMILESCCC(=O)CC.OO
InChIInChI=1S/C5H10O.H2O2/c1-3-5(6)4-2;1-2/h3-4H2,1-2H3;1-2H
InChIKeyGZYNJAULMJBALZ-UHFFFAOYSA-N
MW120.15 g/mol
LogP1.39
Rot. Bonds2

About hydrogen peroxide;pentan-3-one

hydrogen peroxide;pentan-3-one (PubChem CID 18361632) has the molecular formula C5H12O3 and a molecular weight of 120.15 g/mol. Its IUPAC name is hydrogen peroxide;pentan-3-one.

Molecular Properties

Compound Namehydrogen peroxide;pentan-3-one
PubChem CID18361632
Molecular FormulaC5H12O3
Molecular Weight120.15 g/mol
Exact Mass120.08
IUPAC Namehydrogen peroxide;pentan-3-one
SMILESCCC(=O)CC.OO
InChIInChI=1S/C5H10O.H2O2/c1-3-5(6)4-2;1-2/h3-4H2,1-2H3;1-2H
InChIKeyGZYNJAULMJBALZ-UHFFFAOYSA-N
XLogP1.39
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500120.15
LogP ≤ 51.39
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze hydrogen peroxide;pentan-3-one with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hydrogen peroxide;pentan-3-one?
The IUPAC name of hydrogen peroxide;pentan-3-one (CID 18361632) is hydrogen peroxide;pentan-3-one.
What is the SMILES notation for hydrogen peroxide;pentan-3-one?
The canonical SMILES for hydrogen peroxide;pentan-3-one is CCC(=O)CC.OO.
What is the InChIKey of hydrogen peroxide;pentan-3-one?
The InChIKey is GZYNJAULMJBALZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O.H2O2/c1-3-5(6)4-2;1-2/h3-4H2,1-2H3;1-2H.
What are the key properties of hydrogen peroxide;pentan-3-one?
hydrogen peroxide;pentan-3-one has a molecular weight of 120.15 g/mol, XLogP of 1.39, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen peroxide;pentan-3-one is sourced from PubChem (CID 18361632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).