About hydrogen peroxide;pentan-3-one
hydrogen peroxide;pentan-3-one (PubChem CID 18361632) has the molecular formula C5H12O3
and a molecular weight of 120.15 g/mol. Its IUPAC name is hydrogen peroxide;pentan-3-one.
Molecular Properties
| Compound Name | hydrogen peroxide;pentan-3-one |
| PubChem CID | 18361632 |
| Molecular Formula | C5H12O3 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.08 |
| IUPAC Name | hydrogen peroxide;pentan-3-one |
| SMILES | CCC(=O)CC.OO |
| InChI | InChI=1S/C5H10O.H2O2/c1-3-5(6)4-2;1-2/h3-4H2,1-2H3;1-2H |
| InChIKey | GZYNJAULMJBALZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze hydrogen peroxide;pentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrogen peroxide;pentan-3-one?
The IUPAC name of hydrogen peroxide;pentan-3-one (CID 18361632) is hydrogen peroxide;pentan-3-one.
What is the SMILES notation for hydrogen peroxide;pentan-3-one?
The canonical SMILES for hydrogen peroxide;pentan-3-one is CCC(=O)CC.OO.
What is the InChIKey of hydrogen peroxide;pentan-3-one?
The InChIKey is GZYNJAULMJBALZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O.H2O2/c1-3-5(6)4-2;1-2/h3-4H2,1-2H3;1-2H.
What are the key properties of hydrogen peroxide;pentan-3-one?
hydrogen peroxide;pentan-3-one has a molecular weight of 120.15 g/mol, XLogP of 1.39, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen peroxide;pentan-3-one is sourced from PubChem (CID 18361632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).